C23H19N3O2S — CID 155531033
1-(4-methylphenyl)sulfonyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]benzimidazole (PubChem CID 155531033) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]benzimidazole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]benzimidazole |
|---|---|
| PubChem CID | 155531033 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]benzimidazole |
| SMILES | Cc1ccc(S(=O)(=O)n2c(/C=C/C=C/c3ccncc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H19N3O2S/c1-18-10-12-20(13-11-18)29(27,28)26-22-8-4-3-7-21(22)25-23(26)9-5-2-6-19-14-16-24-17-15-19/h2-17H,1H3/b6-2+,9-5+ |
| InChIKey | UCPUGIDKQGYMHC-VDESZNBCSA-N |
| XLogP | 4.70 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|