C18H19N3O3S2 — CID 992142
3-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-ethylpropanamide (PubChem CID 992142) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-ethylpropanamide.
| Compound Name | 3-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-ethylpropanamide |
|---|---|
| PubChem CID | 992142 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-ethylpropanamide |
| SMILES | CCNC(=O)CCSc1nc2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-2-19-17(22)12-13-25-18-20-15-10-6-7-11-16(15)21(18)26(23,24)14-8-4-3-5-9-14/h3-11H,2,12-13H2,1H3,(H,19,22) |
| InChIKey | MTCMBVPBFLJILG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |