C23H20N4O6S2 — CID 4118782
N-[(2-methoxyphenyl)methyl]-2-[1-(3-nitrophenyl)sulfonylbenzimidazol-2-yl]sulfanylacetamide (PubChem CID 4118782) has the molecular formula C23H20N4O6S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-[1-(3-nitrophenyl)sulfonylbenzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-[1-(3-nitrophenyl)sulfonylbenzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4118782 |
| Molecular Formula | C23H20N4O6S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-[1-(3-nitrophenyl)sulfonylbenzimidazol-2-yl]sulfanylacetamide |
| SMILES | COc1ccccc1CNC(=O)CSc1nc2ccccc2n1S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N4O6S2/c1-33-21-12-5-2-7-16(21)14-24-22(28)15-34-23-25-19-10-3-4-11-20(19)26(23)35(31,32)18-9-6-8-17(13-18)27(29)30/h2-13H,14-15H2,1H3,(H,24,28) |
| InChIKey | HTCSAXNOLCMRLV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|