C23H21N3O4S2 — CID 39929865
2-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-(4-methoxy-2-methylphenyl)acetamide (PubChem CID 39929865) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-(4-methoxy-2-methylphenyl)acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-(4-methoxy-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 39929865 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-[1-(benzenesulfonyl)benzimidazol-2-yl]sulfanyl-N-(4-methoxy-2-methylphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3ccccc3n2S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H21N3O4S2/c1-16-14-17(30-2)12-13-19(16)24-22(27)15-31-23-25-20-10-6-7-11-21(20)26(23)32(28,29)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3,(H,24,27) |
| InChIKey | MKKJBLVKPMDMDF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |