C19H14FN3O3S3 — CID 6616695
N-(2-fluorophenyl)-2-(1-thiophen-2-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 6616695) has the molecular formula C19H14FN3O3S3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(1-thiophen-2-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(2-fluorophenyl)-2-(1-thiophen-2-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 6616695 |
| Molecular Formula | C19H14FN3O3S3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-(2-fluorophenyl)-2-(1-thiophen-2-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2n1S(=O)(=O)c1cccs1)Nc1ccccc1F |
| InChI | InChI=1S/C19H14FN3O3S3/c20-13-6-1-2-7-14(13)21-17(24)12-28-19-22-15-8-3-4-9-16(15)23(19)29(25,26)18-10-5-11-27-18/h1-11H,12H2,(H,21,24) |
| InChIKey | FRZLAHKVIILXEQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |