C25H27Cl2N3O2 — CID 4617419
3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one (PubChem CID 4617419) has the molecular formula C25H27Cl2N3O2 and a molecular weight of 472.42 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4617419 |
| Molecular Formula | C25H27Cl2N3O2 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1cc(C=C(C(=O)c2ccc(Cl)cc2Cl)n2cncn2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H27Cl2N3O2/c1-24(2,3)18-9-15(10-19(23(18)32)25(4,5)6)11-21(30-14-28-13-29-30)22(31)17-8-7-16(26)12-20(17)27/h7-14,32H,1-6H3 |
| InChIKey | NIPRJEQJYKBYTD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|