C17H13Cl2N3OSe — CID 86741080
1-(2,4-dichlorophenyl)-2-phenylselanyl-2-(1,2,4-triazol-1-yl)propan-1-one (PubChem CID 86741080) has the molecular formula C17H13Cl2N3OSe and a molecular weight of 425.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-phenylselanyl-2-(1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2-phenylselanyl-2-(1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 86741080 |
| Molecular Formula | C17H13Cl2N3OSe |
| Molecular Weight | 425.18 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-phenylselanyl-2-(1,2,4-triazol-1-yl)propan-1-one |
| SMILES | CC([Se]c1ccccc1)(C(=O)c1ccc(Cl)cc1Cl)n1cncn1 |
| InChI | InChI=1S/C17H13Cl2N3OSe/c1-17(22-11-20-10-21-22,24-13-5-3-2-4-6-13)16(23)14-8-7-12(18)9-15(14)19/h2-11H,1H3 |
| InChIKey | BVEMRCBYQXWDQU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|