C12H11Cl2N5O2 — CID 136919721
N-[(Z)-(3,4-dichlorophenyl)methoxyiminomethyl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 136919721) has the molecular formula C12H11Cl2N5O2 and a molecular weight of 328.16 g/mol. Its IUPAC name is N-[(Z)-(3,4-dichlorophenyl)methoxyiminomethyl]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(Z)-(3,4-dichlorophenyl)methoxyiminomethyl]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 136919721 |
| Molecular Formula | C12H11Cl2N5O2 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-[(Z)-(3,4-dichlorophenyl)methoxyiminomethyl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)N/C=N\OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N5O2/c13-10-2-1-9(3-11(10)14)5-21-18-7-16-12(20)4-19-8-15-6-17-19/h1-3,6-8H,4-5H2,(H,16,18,20) |
| InChIKey | JOZCTMCANLLRRV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|