C10H7Cl2N3O — CID 10038017
1-(3,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 10038017) has the molecular formula C10H7Cl2N3O and a molecular weight of 256.09 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 10038017 |
| Molecular Formula | C10H7Cl2N3O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cncn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2N3O/c11-8-2-1-7(3-9(8)12)10(16)4-15-6-13-5-14-15/h1-3,5-6H,4H2 |
| InChIKey | MJUYTIHZMMPVBY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |