C14H16Cl2N4O — CID 56822052
N-[1-(3,4-dichlorophenyl)butyl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 56822052) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)butyl]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)butyl]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 56822052 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)butyl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | CCCC(NC(=O)Cn1cncn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N4O/c1-2-3-13(10-4-5-11(15)12(16)6-10)19-14(21)7-20-9-17-8-18-20/h4-6,8-9,13H,2-3,7H2,1H3,(H,19,21) |
| InChIKey | CHBLDSUBAYYQDO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |