C10H14N4O — CID 103529009
N-hex-1-yn-3-yl-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 103529009) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-hex-1-yn-3-yl-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 103529009 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-hex-1-yn-3-yl-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | C#CC(CCC)NC(=O)Cn1cncn1 |
| InChI | InChI=1S/C10H14N4O/c1-3-5-9(4-2)13-10(15)6-14-8-11-7-12-14/h2,7-9H,3,5-6H2,1H3,(H,13,15) |
| InChIKey | APALUYYGXIABFZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|