C14H16Cl2N4O — CID 54239401
N-[(3,4-dichlorophenyl)methoxy]-2,2-dimethyl-1-(1,2,4-triazol-1-yl)propan-1-imine (PubChem CID 54239401) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methoxy]-2,2-dimethyl-1-(1,2,4-triazol-1-yl)propan-1-imine.
| Compound Name | N-[(3,4-dichlorophenyl)methoxy]-2,2-dimethyl-1-(1,2,4-triazol-1-yl)propan-1-imine |
|---|---|
| PubChem CID | 54239401 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methoxy]-2,2-dimethyl-1-(1,2,4-triazol-1-yl)propan-1-imine |
| SMILES | CC(C)(C)C(=NOCc1ccc(Cl)c(Cl)c1)n1cncn1 |
| InChI | InChI=1S/C14H16Cl2N4O/c1-14(2,3)13(20-9-17-8-18-20)19-21-7-10-4-5-11(15)12(16)6-10/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | QOXUGSKQEAYQPJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|