C19H19ClN4O2 — CID 54527494
3-[(4-chlorophenyl)methoxyimino]-2-phenyl-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 54527494) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methoxyimino]-2-phenyl-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 3-[(4-chlorophenyl)methoxyimino]-2-phenyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 54527494 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3-[(4-chlorophenyl)methoxyimino]-2-phenyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(=NOCc1ccc(Cl)cc1)C(O)(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-15(23-26-11-16-7-9-18(20)10-8-16)19(25,12-24-14-21-13-22-24)17-5-3-2-4-6-17/h2-10,13-14,25H,11-12H2,1H3 |
| InChIKey | YUDPQGPYMHUPSN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|