C19H18Cl2N4O2 — CID 57118863
3-[(3,4-dichlorophenyl)methoxyamino]-2-phenyl-1-(1,2,4-triazol-1-yl)but-3-en-2-ol (PubChem CID 57118863) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methoxyamino]-2-phenyl-1-(1,2,4-triazol-1-yl)but-3-en-2-ol.
| Compound Name | 3-[(3,4-dichlorophenyl)methoxyamino]-2-phenyl-1-(1,2,4-triazol-1-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 57118863 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methoxyamino]-2-phenyl-1-(1,2,4-triazol-1-yl)but-3-en-2-ol |
| SMILES | C=C(NOCc1ccc(Cl)c(Cl)c1)C(O)(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C19H18Cl2N4O2/c1-14(24-27-10-15-7-8-17(20)18(21)9-15)19(26,11-25-13-22-12-23-25)16-5-3-2-4-6-16/h2-9,12-13,24,26H,1,10-11H2 |
| InChIKey | WWYYTTWCSUXCBN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|