C18H21Cl2N3O3 — CID 70533708
3-(3,4-dichlorophenyl)-1-(2-ethyl-5-methyl-1,3-dioxan-5-yl)-2-(1,2,4-triazol-1-yl)prop-1-en-1-ol (PubChem CID 70533708) has the molecular formula C18H21Cl2N3O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-(2-ethyl-5-methyl-1,3-dioxan-5-yl)-2-(1,2,4-triazol-1-yl)prop-1-en-1-ol.
| Compound Name | 3-(3,4-dichlorophenyl)-1-(2-ethyl-5-methyl-1,3-dioxan-5-yl)-2-(1,2,4-triazol-1-yl)prop-1-en-1-ol |
|---|---|
| PubChem CID | 70533708 |
| Molecular Formula | C18H21Cl2N3O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-(2-ethyl-5-methyl-1,3-dioxan-5-yl)-2-(1,2,4-triazol-1-yl)prop-1-en-1-ol |
| SMILES | CCC1OCC(C)(C(O)=C(Cc2ccc(Cl)c(Cl)c2)n2cncn2)CO1 |
| InChI | InChI=1S/C18H21Cl2N3O3/c1-3-16-25-8-18(2,9-26-16)17(24)15(23-11-21-10-22-23)7-12-4-5-13(19)14(20)6-12/h4-6,10-11,16,24H,3,7-9H2,1-2H3 |
| InChIKey | RLXJFFXFFUBYFN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|