C18H20Cl2N4O2 — CID 172659630
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 172659630) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 172659630 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1C[C@H]2C[C@@H](n3cncn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C18H20Cl2N4O2/c19-14-2-1-11(3-15(14)20)4-18(26)23-7-12-5-16(24-10-21-9-22-24)17(25)6-13(12)8-23/h1-3,9-10,12-13,16-17,25H,4-8H2/t12-,13+,16-,17-/m1/s1 |
| InChIKey | AJMROPVRBSMDQO-DLTLXFJOSA-N |
| XLogP | 2.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |