C19H23ClN4O2 — CID 172668129
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-chlorophenyl)propan-1-one (PubChem CID 172668129) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-chlorophenyl)propan-1-one.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-chlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 172668129 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-chlorophenyl)propan-1-one |
| SMILES | O=C(CCc1ccccc1Cl)N1C[C@H]2C[C@@H](n3cncn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C19H23ClN4O2/c20-16-4-2-1-3-13(16)5-6-19(26)23-9-14-7-17(24-12-21-11-22-24)18(25)8-15(14)10-23/h1-4,11-12,14-15,17-18,25H,5-10H2/t14-,15+,17-,18-/m1/s1 |
| InChIKey | YPZPXOHBGSSUOX-CYGHRXIMSA-N |
| XLogP | 2.33 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |