C12H12Cl2O — CID 82293557
1-[1-[(2,4-dichlorophenyl)methyl]cyclopropyl]ethanone (PubChem CID 82293557) has the molecular formula C12H12Cl2O and a molecular weight of 243.13 g/mol. Its IUPAC name is 1-[1-[(2,4-dichlorophenyl)methyl]cyclopropyl]ethanone.
| Compound Name | 1-[1-[(2,4-dichlorophenyl)methyl]cyclopropyl]ethanone |
|---|---|
| PubChem CID | 82293557 |
| Molecular Formula | C12H12Cl2O |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-[1-[(2,4-dichlorophenyl)methyl]cyclopropyl]ethanone |
| SMILES | CC(=O)C1(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C12H12Cl2O/c1-8(15)12(4-5-12)7-9-2-3-10(13)6-11(9)14/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | VIXGCCLJGLGBAS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |