C13H15BrO — CID 130609745
1-[1-[(5-bromo-2-methylphenyl)methyl]cyclopropyl]ethanone (PubChem CID 130609745) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is 1-[1-[(5-bromo-2-methylphenyl)methyl]cyclopropyl]ethanone.
| Compound Name | 1-[1-[(5-bromo-2-methylphenyl)methyl]cyclopropyl]ethanone |
|---|---|
| PubChem CID | 130609745 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1-[1-[(5-bromo-2-methylphenyl)methyl]cyclopropyl]ethanone |
| SMILES | CC(=O)C1(Cc2cc(Br)ccc2C)CC1 |
| InChI | InChI=1S/C13H15BrO/c1-9-3-4-12(14)7-11(9)8-13(5-6-13)10(2)15/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | BMHAILZUAWXXGV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |