C13H14BrN — CID 116929246
1-[(5-bromo-2-methylphenyl)methyl]cyclobutane-1-carbonitrile (PubChem CID 116929246) has the molecular formula C13H14BrN and a molecular weight of 264.17 g/mol. Its IUPAC name is 1-[(5-bromo-2-methylphenyl)methyl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[(5-bromo-2-methylphenyl)methyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 116929246 |
| Molecular Formula | C13H14BrN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 1-[(5-bromo-2-methylphenyl)methyl]cyclobutane-1-carbonitrile |
| SMILES | Cc1ccc(Br)cc1CC1(C#N)CCC1 |
| InChI | InChI=1S/C13H14BrN/c1-10-3-4-12(14)7-11(10)8-13(9-15)5-2-6-13/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | MVKIBGKELQZEJJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |