C14H18Cl2OS — CID 79955546
3-[(2,4-dichlorophenyl)methyl]-4,4-dimethylthian-3-ol (PubChem CID 79955546) has the molecular formula C14H18Cl2OS and a molecular weight of 305.27 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-4,4-dimethylthian-3-ol.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-4,4-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79955546 |
| Molecular Formula | C14H18Cl2OS |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-4,4-dimethylthian-3-ol |
| SMILES | CC1(C)CCSCC1(O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2OS/c1-13(2)5-6-18-9-14(13,17)8-10-3-4-11(15)7-12(10)16/h3-4,7,17H,5-6,8-9H2,1-2H3 |
| InChIKey | BONIBVZKMBSCRM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |