C15H19F3OS — CID 79955355
4,4-dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]thian-3-ol (PubChem CID 79955355) has the molecular formula C15H19F3OS and a molecular weight of 304.38 g/mol. Its IUPAC name is 4,4-dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]thian-3-ol.
| Compound Name | 4,4-dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]thian-3-ol |
|---|---|
| PubChem CID | 79955355 |
| Molecular Formula | C15H19F3OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4,4-dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]thian-3-ol |
| SMILES | CC1(C)CCSCC1(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3OS/c1-13(2)7-8-20-10-14(13,19)9-11-3-5-12(6-4-11)15(16,17)18/h3-6,19H,7-10H2,1-2H3 |
| InChIKey | LBVVFHMHOAXHPP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |