C13H14F3NO — CID 104687321
5-methyl-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 104687321) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 5-methyl-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 5-methyl-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 104687321 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-methyl-5-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | CC1(Cc2ccc(C(F)(F)F)cc2)CCC(=O)N1 |
| InChI | InChI=1S/C13H14F3NO/c1-12(7-6-11(18)17-12)8-9-2-4-10(5-3-9)13(14,15)16/h2-5H,6-8H2,1H3,(H,17,18) |
| InChIKey | LXPXOBUDXNMVEA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |