C12H14ClNO — CID 104687299
5-[(3-chlorophenyl)methyl]-5-methylpyrrolidin-2-one (PubChem CID 104687299) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-5-methylpyrrolidin-2-one.
| Compound Name | 5-[(3-chlorophenyl)methyl]-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 104687299 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-5-methylpyrrolidin-2-one |
| SMILES | CC1(Cc2cccc(Cl)c2)CCC(=O)N1 |
| InChI | InChI=1S/C12H14ClNO/c1-12(6-5-11(15)14-12)8-9-3-2-4-10(13)7-9/h2-4,7H,5-6,8H2,1H3,(H,14,15) |
| InChIKey | CAOCMSMXUPJEHH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |