C17H23ClO5 — CID 67254603
3-[(3-chlorophenyl)methyl]-2,2-bis(methoxymethoxy)-3-methylcyclopentan-1-one (PubChem CID 67254603) has the molecular formula C17H23ClO5 and a molecular weight of 342.82 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-2,2-bis(methoxymethoxy)-3-methylcyclopentan-1-one.
| Compound Name | 3-[(3-chlorophenyl)methyl]-2,2-bis(methoxymethoxy)-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 67254603 |
| Molecular Formula | C17H23ClO5 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-2,2-bis(methoxymethoxy)-3-methylcyclopentan-1-one |
| SMILES | COCOC1(OCOC)C(=O)CCC1(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClO5/c1-16(10-13-5-4-6-14(18)9-13)8-7-15(19)17(16,22-11-20-2)23-12-21-3/h4-6,9H,7-8,10-12H2,1-3H3 |
| InChIKey | BUHCJBJSTZQECN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|