C12H17Cl2N — CID 122156828
2-[(3-chlorophenyl)methyl]-2-methylpyrrolidine;hydrochloride (PubChem CID 122156828) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-2-methylpyrrolidine;hydrochloride.
| Compound Name | 2-[(3-chlorophenyl)methyl]-2-methylpyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 122156828 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-2-methylpyrrolidine;hydrochloride |
| SMILES | CC1(Cc2cccc(Cl)c2)CCCN1.Cl |
| InChI | InChI=1S/C12H16ClN.ClH/c1-12(6-3-7-14-12)9-10-4-2-5-11(13)8-10;/h2,4-5,8,14H,3,6-7,9H2,1H3;1H |
| InChIKey | PAHJQYGZAJRONE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |