C16H19F3O2 — CID 86210946
2-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]cyclooctan-1-one (PubChem CID 86210946) has the molecular formula C16H19F3O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]cyclooctan-1-one.
| Compound Name | 2-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]cyclooctan-1-one |
|---|---|
| PubChem CID | 86210946 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]cyclooctan-1-one |
| SMILES | O=C1CCCCCCC1(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3O2/c17-16(18,19)13-8-6-12(7-9-13)11-15(21)10-4-2-1-3-5-14(15)20/h6-9,21H,1-5,10-11H2 |
| InChIKey | RCVWWZPWKXDRID-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |