C14H16F3NO — CID 156803398
(2S)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]cyclohexan-1-one (PubChem CID 156803398) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is (2S)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]cyclohexan-1-one.
| Compound Name | (2S)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 156803398 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2S)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]cyclohexan-1-one |
| SMILES | CN[C@]1(c2ccc(C(F)(F)F)cc2)CCCCC1=O |
| InChI | InChI=1S/C14H16F3NO/c1-18-13(9-3-2-4-12(13)19)10-5-7-11(8-6-10)14(15,16)17/h5-8,18H,2-4,9H2,1H3/t13-/m0/s1 |
| InChIKey | WAYLLVIKXHXBHU-ZDUSSCGKSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |