C18H20Cl2N2O2 — CID 141076402
(3E)-3-[(2,4-dichlorophenyl)methoxyimino]-N-methoxy-N-methyl-3-phenylpropan-1-amine (PubChem CID 141076402) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is (3E)-3-[(2,4-dichlorophenyl)methoxyimino]-N-methoxy-N-methyl-3-phenylpropan-1-amine.
| Compound Name | (3E)-3-[(2,4-dichlorophenyl)methoxyimino]-N-methoxy-N-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 141076402 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (3E)-3-[(2,4-dichlorophenyl)methoxyimino]-N-methoxy-N-methyl-3-phenylpropan-1-amine |
| SMILES | CON(C)CC/C(=N\OCc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c1-22(23-2)11-10-18(14-6-4-3-5-7-14)21-24-13-15-8-9-16(19)12-17(15)20/h3-9,12H,10-11,13H2,1-2H3/b21-18+ |
| InChIKey | KQPAJFTYIFGERY-DYTRJAOYSA-N |
| XLogP | 4.80 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|