C19H19Cl2NO2 — CID 171982927
[(Z)-1-phenylhexylideneamino] 2,4-dichlorobenzoate (PubChem CID 171982927) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is [(Z)-1-phenylhexylideneamino] 2,4-dichlorobenzoate.
| Compound Name | [(Z)-1-phenylhexylideneamino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 171982927 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [(Z)-1-phenylhexylideneamino] 2,4-dichlorobenzoate |
| SMILES | CCCCC/C(=N/OC(=O)c1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H19Cl2NO2/c1-2-3-5-10-18(14-8-6-4-7-9-14)22-24-19(23)16-12-11-15(20)13-17(16)21/h4,6-9,11-13H,2-3,5,10H2,1H3/b22-18- |
| InChIKey | SFTGXXOQBDKFDG-PYCFMQQDSA-N |
| XLogP | 6.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|