C22H24Cl2O2 — CID 158169372
1-[4-(2,4-dichlorobenzoyl)phenyl]nonan-1-one (PubChem CID 158169372) has the molecular formula C22H24Cl2O2 and a molecular weight of 391.34 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorobenzoyl)phenyl]nonan-1-one.
| Compound Name | 1-[4-(2,4-dichlorobenzoyl)phenyl]nonan-1-one |
|---|---|
| PubChem CID | 158169372 |
| Molecular Formula | C22H24Cl2O2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-[4-(2,4-dichlorobenzoyl)phenyl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1ccc(C(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H24Cl2O2/c1-2-3-4-5-6-7-8-21(25)16-9-11-17(12-10-16)22(26)19-14-13-18(23)15-20(19)24/h9-15H,2-8H2,1H3 |
| InChIKey | FOZKVYYDBFKBMY-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|