About 1,2-dichlorobenzene;ethoxyethane
1,2-dichlorobenzene;ethoxyethane (PubChem CID 68845412) has the molecular formula C10H14Cl2O
and a molecular weight of 221.13 g/mol. Its IUPAC name is 1,2-dichlorobenzene;ethoxyethane.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;ethoxyethane |
| PubChem CID | 68845412 |
| Molecular Formula | C10H14Cl2O |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 1,2-dichlorobenzene;ethoxyethane |
| SMILES | CCOCC.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.C4H10O/c7-5-3-1-2-4-6(5)8;1-3-5-4-2/h1-4H;3-4H2,1-2H3 |
| InChIKey | HAAGZVRWLWPHIG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dichlorobenzene;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;ethoxyethane?
The IUPAC name of 1,2-dichlorobenzene;ethoxyethane (CID 68845412) is 1,2-dichlorobenzene;ethoxyethane.
What is the SMILES notation for 1,2-dichlorobenzene;ethoxyethane?
The canonical SMILES for 1,2-dichlorobenzene;ethoxyethane is CCOCC.Clc1ccccc1Cl.
What is the InChIKey of 1,2-dichlorobenzene;ethoxyethane?
The InChIKey is HAAGZVRWLWPHIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C4H10O/c7-5-3-1-2-4-6(5)8;1-3-5-4-2/h1-4H;3-4H2,1-2H3.
What are the key properties of 1,2-dichlorobenzene;ethoxyethane?
1,2-dichlorobenzene;ethoxyethane has a molecular weight of 221.13 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;ethoxyethane is sourced from PubChem (CID 68845412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).