About 1,1'-biphenyl;ethene;ethoxyethane
1,1'-biphenyl;ethene;ethoxyethane (PubChem CID 155168221) has the molecular formula C18H24O
and a molecular weight of 256.39 g/mol. Its IUPAC name is 1,1'-biphenyl;ethene;ethoxyethane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;ethene;ethoxyethane |
| PubChem CID | 155168221 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1,1'-biphenyl;ethene;ethoxyethane |
| SMILES | C=C.CCOCC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H10O.C2H4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2;1-2/h1-10H;3-4H2,1-2H3;1-2H2 |
| InChIKey | CYSSJBTZRKNEAF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;ethene;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;ethene;ethoxyethane?
The IUPAC name of 1,1'-biphenyl;ethene;ethoxyethane (CID 155168221) is 1,1'-biphenyl;ethene;ethoxyethane.
What is the SMILES notation for 1,1'-biphenyl;ethene;ethoxyethane?
The canonical SMILES for 1,1'-biphenyl;ethene;ethoxyethane is C=C.CCOCC.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;ethene;ethoxyethane?
The InChIKey is CYSSJBTZRKNEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C4H10O.C2H4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2;1-2/h1-10H;3-4H2,1-2H3;1-2H2.
What are the key properties of 1,1'-biphenyl;ethene;ethoxyethane?
1,1'-biphenyl;ethene;ethoxyethane has a molecular weight of 256.39 g/mol, XLogP of 5.20, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;ethene;ethoxyethane is sourced from PubChem (CID 155168221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).