C28H30O3S — CID 67285974
benzenesulfonylbenzene;1,1'-biphenyl;ethoxyethane (PubChem CID 67285974) has the molecular formula C28H30O3S and a molecular weight of 446.61 g/mol. Its IUPAC name is benzenesulfonylbenzene;1,1'-biphenyl;ethoxyethane.
| Compound Name | benzenesulfonylbenzene;1,1'-biphenyl;ethoxyethane |
|---|---|
| PubChem CID | 67285974 |
| Molecular Formula | C28H30O3S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | benzenesulfonylbenzene;1,1'-biphenyl;ethoxyethane |
| SMILES | CCOCC.O=S(=O)(c1ccccc1)c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O2S.C12H10.C4H10O/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;1-10H;3-4H2,1-2H3 |
| InChIKey | OHNMWOKHMWEIKP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |