About 1-chloro-2-iodobenzene;ethoxyethane
1-chloro-2-iodobenzene;ethoxyethane (PubChem CID 67785731) has the molecular formula C10H14ClIO
and a molecular weight of 312.58 g/mol. Its IUPAC name is 1-chloro-2-iodobenzene;ethoxyethane.
Molecular Properties
| Compound Name | 1-chloro-2-iodobenzene;ethoxyethane |
| PubChem CID | 67785731 |
| Molecular Formula | C10H14ClIO |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 1-chloro-2-iodobenzene;ethoxyethane |
| SMILES | CCOCC.Clc1ccccc1I |
| InChI | InChI=1S/C6H4ClI.C4H10O/c7-5-3-1-2-4-6(5)8;1-3-5-4-2/h1-4H;3-4H2,1-2H3 |
| InChIKey | ITEDNPCVQOSCBX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-iodobenzene;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-iodobenzene;ethoxyethane?
The IUPAC name of 1-chloro-2-iodobenzene;ethoxyethane (CID 67785731) is 1-chloro-2-iodobenzene;ethoxyethane.
What is the SMILES notation for 1-chloro-2-iodobenzene;ethoxyethane?
The canonical SMILES for 1-chloro-2-iodobenzene;ethoxyethane is CCOCC.Clc1ccccc1I.
What is the InChIKey of 1-chloro-2-iodobenzene;ethoxyethane?
The InChIKey is ITEDNPCVQOSCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClI.C4H10O/c7-5-3-1-2-4-6(5)8;1-3-5-4-2/h1-4H;3-4H2,1-2H3.
What are the key properties of 1-chloro-2-iodobenzene;ethoxyethane?
1-chloro-2-iodobenzene;ethoxyethane has a molecular weight of 312.58 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-iodobenzene;ethoxyethane is sourced from PubChem (CID 67785731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).