C13H7Cl3N2O — CID 133092382
2-[2-oxo-3-(2,4,6-trichlorophenyl)-1H-pyridin-4-yl]acetonitrile (PubChem CID 133092382) has the molecular formula C13H7Cl3N2O and a molecular weight of 313.57 g/mol. Its IUPAC name is 2-[2-oxo-3-(2,4,6-trichlorophenyl)-1H-pyridin-4-yl]acetonitrile.
| Compound Name | 2-[2-oxo-3-(2,4,6-trichlorophenyl)-1H-pyridin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 133092382 |
| Molecular Formula | C13H7Cl3N2O |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 2-[2-oxo-3-(2,4,6-trichlorophenyl)-1H-pyridin-4-yl]acetonitrile |
| SMILES | N#CCc1cc[nH]c(=O)c1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl3N2O/c14-8-5-9(15)12(10(16)6-8)11-7(1-3-17)2-4-18-13(11)19/h2,4-6H,1H2,(H,18,19) |
| InChIKey | OXKFNOSVOHPLJB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |