C13H4Cl3F3N2 — CID 134628594
5-(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 134628594) has the molecular formula C13H4Cl3F3N2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 5-(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 134628594 |
| Molecular Formula | C13H4Cl3F3N2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 5-(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(-c2cc(Cl)c(Cl)cc2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C13H4Cl3F3N2/c14-9-3-11(16)10(15)2-7(9)6-1-8(13(17,18)19)12(4-20)21-5-6/h1-3,5H |
| InChIKey | WMGXXEUJDHROQP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|