C20H10F6N2 — CID 134623343
3,5-bis[2-(trifluoromethyl)phenyl]pyridine-2-carbonitrile (PubChem CID 134623343) has the molecular formula C20H10F6N2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 3,5-bis[2-(trifluoromethyl)phenyl]pyridine-2-carbonitrile.
| Compound Name | 3,5-bis[2-(trifluoromethyl)phenyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 134623343 |
| Molecular Formula | C20H10F6N2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3,5-bis[2-(trifluoromethyl)phenyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(-c2ccccc2C(F)(F)F)cc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H10F6N2/c21-19(22,23)16-7-3-1-5-13(16)12-9-15(18(10-27)28-11-12)14-6-2-4-8-17(14)20(24,25)26/h1-9,11H |
| InChIKey | HVZNBCFZVKFOKR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |