C19H12F6N2 — CID 134624057
2,5-bis[2-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 134624057) has the molecular formula C19H12F6N2 and a molecular weight of 382.31 g/mol. Its IUPAC name is 2,5-bis[2-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | 2,5-bis[2-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 134624057 |
| Molecular Formula | C19H12F6N2 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2,5-bis[2-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | Nc1cc(-c2ccccc2C(F)(F)F)cnc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H12F6N2/c20-18(21,22)14-7-3-1-5-12(14)11-9-16(26)17(27-10-11)13-6-2-4-8-15(13)19(23,24)25/h1-10H,26H2 |
| InChIKey | BMAYIRSZCCAATK-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |