C12H6Cl2F3N — CID 118815216
2,3-dichloro-5-[2-(trifluoromethyl)phenyl]pyridine (PubChem CID 118815216) has the molecular formula C12H6Cl2F3N and a molecular weight of 292.09 g/mol. Its IUPAC name is 2,3-dichloro-5-[2-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2,3-dichloro-5-[2-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 118815216 |
| Molecular Formula | C12H6Cl2F3N |
| Molecular Weight | 292.09 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 2,3-dichloro-5-[2-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1ccccc1-c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H6Cl2F3N/c13-10-5-7(6-18-11(10)14)8-3-1-2-4-9(8)12(15,16)17/h1-6H |
| InChIKey | KBZPKSREMYRNHO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.09 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|