C21H12F6N2 — CID 134623346
2-[3,5-bis[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile (PubChem CID 134623346) has the molecular formula C21H12F6N2 and a molecular weight of 406.33 g/mol. Its IUPAC name is 2-[3,5-bis[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile.
| Compound Name | 2-[3,5-bis[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134623346 |
| Molecular Formula | C21H12F6N2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[3,5-bis[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(-c2ccccc2C(F)(F)F)cc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H12F6N2/c22-20(23,24)17-7-3-1-5-14(17)13-11-16(19(9-10-28)29-12-13)15-6-2-4-8-18(15)21(25,26)27/h1-8,11-12H,9H2 |
| InChIKey | ZKQPRZGZTBQEME-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |