C15H8F6N2 — CID 134628875
2-[5-(trifluoromethyl)-3-[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile (PubChem CID 134628875) has the molecular formula C15H8F6N2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-3-[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile.
| Compound Name | 2-[5-(trifluoromethyl)-3-[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134628875 |
| Molecular Formula | C15H8F6N2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[5-(trifluoromethyl)-3-[2-(trifluoromethyl)phenyl]-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(C(F)(F)F)cc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H8F6N2/c16-14(17,18)9-7-11(13(5-6-22)23-8-9)10-3-1-2-4-12(10)15(19,20)21/h1-4,7-8H,5H2 |
| InChIKey | YZUSVGSEOFALGM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |