C16H9F6N — CID 118996851
2-[3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]phenyl]acetonitrile (PubChem CID 118996851) has the molecular formula C16H9F6N and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]phenyl]acetonitrile.
| Compound Name | 2-[3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 118996851 |
| Molecular Formula | C16H9F6N |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-[3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(-c2ccccc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H9F6N/c17-15(18,19)13-4-2-1-3-11(13)12-6-5-10(7-8-23)9-14(12)16(20,21)22/h1-6,9H,7H2 |
| InChIKey | JPMDDUHWVVTWQK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |