C12H5Cl2FN2 — CID 133095931
5-(3,4-dichlorophenyl)-3-fluoropyridine-2-carbonitrile (PubChem CID 133095931) has the molecular formula C12H5Cl2FN2 and a molecular weight of 267.09 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-3-fluoropyridine-2-carbonitrile.
| Compound Name | 5-(3,4-dichlorophenyl)-3-fluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133095931 |
| Molecular Formula | C12H5Cl2FN2 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-3-fluoropyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(-c2ccc(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C12H5Cl2FN2/c13-9-2-1-7(3-10(9)14)8-4-11(15)12(5-16)17-6-8/h1-4,6H |
| InChIKey | PWKFEDCZXXEYPK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |