C10H5Cl2FN2 — CID 130167089
5-(3,4-dichlorophenyl)-2-fluoropyrimidine (PubChem CID 130167089) has the molecular formula C10H5Cl2FN2 and a molecular weight of 243.07 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-2-fluoropyrimidine.
| Compound Name | 5-(3,4-dichlorophenyl)-2-fluoropyrimidine |
|---|---|
| PubChem CID | 130167089 |
| Molecular Formula | C10H5Cl2FN2 |
| Molecular Weight | 243.07 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-2-fluoropyrimidine |
| SMILES | Fc1ncc(-c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C10H5Cl2FN2/c11-8-2-1-6(3-9(8)12)7-4-14-10(13)15-5-7/h1-5H |
| InChIKey | NHZGEAFLXSMQGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |