C12H6Cl2F2 — CID 134623188
1,2-dichloro-4-(3,5-difluorophenyl)benzene (PubChem CID 134623188) has the molecular formula C12H6Cl2F2 and a molecular weight of 259.08 g/mol. Its IUPAC name is 1,2-dichloro-4-(3,5-difluorophenyl)benzene.
| Compound Name | 1,2-dichloro-4-(3,5-difluorophenyl)benzene |
|---|---|
| PubChem CID | 134623188 |
| Molecular Formula | C12H6Cl2F2 |
| Molecular Weight | 259.08 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 1,2-dichloro-4-(3,5-difluorophenyl)benzene |
| SMILES | Fc1cc(F)cc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H6Cl2F2/c13-11-2-1-7(5-12(11)14)8-3-9(15)6-10(16)4-8/h1-6H |
| InChIKey | QLDVAXJNDGSDGS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.08 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |