About 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene
1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene (PubChem CID 142366576) has the molecular formula C12H6ClF3
and a molecular weight of 242.63 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene |
| PubChem CID | 142366576 |
| Molecular Formula | C12H6ClF3 |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(-c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H6ClF3/c13-11-5-7(1-2-12(11)16)8-3-9(14)6-10(15)4-8/h1-6H |
| InChIKey | FCRGLELVUBUOGU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene?
The IUPAC name of 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene (CID 142366576) is 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene.
What is the SMILES notation for 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene?
The canonical SMILES for 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene is Fc1cc(F)cc(-c2ccc(F)c(Cl)c2)c1.
What is the InChIKey of 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene?
The InChIKey is FCRGLELVUBUOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClF3/c13-11-5-7(1-2-12(11)16)8-3-9(14)6-10(15)4-8/h1-6H.
What are the key properties of 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene?
1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene has a molecular weight of 242.63 g/mol, XLogP of 4.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene is sourced from PubChem (CID 142366576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).