C12H6ClF3 — CID 142366576
1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene (PubChem CID 142366576) has the molecular formula C12H6ClF3 and a molecular weight of 242.63 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 142366576 |
| Molecular Formula | C12H6ClF3 |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(-c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H6ClF3/c13-11-5-7(1-2-12(11)16)8-3-9(14)6-10(15)4-8/h1-6H |
| InChIKey | FCRGLELVUBUOGU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |