C12H4Cl2F4O — CID 134623128
4-(3,4-dichlorophenyl)-2,3,5,6-tetrafluorophenol (PubChem CID 134623128) has the molecular formula C12H4Cl2F4O and a molecular weight of 311.06 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2,3,5,6-tetrafluorophenol.
| Compound Name | 4-(3,4-dichlorophenyl)-2,3,5,6-tetrafluorophenol |
|---|---|
| PubChem CID | 134623128 |
| Molecular Formula | C12H4Cl2F4O |
| Molecular Weight | 311.06 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2,3,5,6-tetrafluorophenol |
| SMILES | Oc1c(F)c(F)c(-c2ccc(Cl)c(Cl)c2)c(F)c1F |
| InChI | InChI=1S/C12H4Cl2F4O/c13-5-2-1-4(3-6(5)14)7-8(15)10(17)12(19)11(18)9(7)16/h1-3,19H |
| InChIKey | NAOVKAVMNFNWKY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.06 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|