C14H10Cl2O3 — CID 82045546
2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid (PubChem CID 82045546) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid.
| Compound Name | 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 82045546 |
| Molecular Formula | C14H10Cl2O3 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid |
| SMILES | Cc1cc(O)cc(C(=O)O)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2O3/c1-7-4-9(17)6-10(14(18)19)13(7)8-2-3-11(15)12(16)5-8/h2-6,17H,1H3,(H,18,19) |
| InChIKey | RNGUMKZMHCTGEF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |