2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid

C14H10Cl2O3 — CID 82045546

IUPAC2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid
SMILESCc1cc(O)cc(C(=O)O)c1-c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C14H10Cl2O3/c1-7-4-9(17)6-10(14(18)19)13(7)8-2-3-11(15)12(16)5-8/h2-6,17H,1H3,(H,18,19)
InChIKeyRNGUMKZMHCTGEF-UHFFFAOYSA-N
MW297.14 g/mol
LogP4.37
Rot. Bonds2

About 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid

2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid (PubChem CID 82045546) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid.

Molecular Properties

Compound Name2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid
PubChem CID82045546
Molecular FormulaC14H10Cl2O3
Molecular Weight297.14 g/mol
Exact Mass296.00
IUPAC Name2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid
SMILESCc1cc(O)cc(C(=O)O)c1-c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C14H10Cl2O3/c1-7-4-9(17)6-10(14(18)19)13(7)8-2-3-11(15)12(16)5-8/h2-6,17H,1H3,(H,18,19)
InChIKeyRNGUMKZMHCTGEF-UHFFFAOYSA-N
XLogP4.37
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.14
LogP ≤ 54.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid?
The IUPAC name of 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid (CID 82045546) is 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid?
The canonical SMILES for 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid is Cc1cc(O)cc(C(=O)O)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid?
The InChIKey is RNGUMKZMHCTGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2O3/c1-7-4-9(17)6-10(14(18)19)13(7)8-2-3-11(15)12(16)5-8/h2-6,17H,1H3,(H,18,19).
What are the key properties of 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid?
2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid has a molecular weight of 297.14 g/mol, XLogP of 4.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-5-hydroxy-3-methylbenzoic acid is sourced from PubChem (CID 82045546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).