4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid

C15H12Cl2O4 — CID 16768707

IUPAC4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid
SMILESCOc1cc(C(=O)O)cc(OC)c1-c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C15H12Cl2O4/c1-20-12-6-9(15(18)19)7-13(21-2)14(12)8-3-4-10(16)11(17)5-8/h3-7H,1-2H3,(H,18,19)
InChIKeyHFJLWZOWQVFVTO-UHFFFAOYSA-N
MW327.16 g/mol
LogP4.38
Rot. Bonds4

About 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid

4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid (PubChem CID 16768707) has the molecular formula C15H12Cl2O4 and a molecular weight of 327.16 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid.

Molecular Properties

Compound Name4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid
PubChem CID16768707
Molecular FormulaC15H12Cl2O4
Molecular Weight327.16 g/mol
Exact Mass326.01
IUPAC Name4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid
SMILESCOc1cc(C(=O)O)cc(OC)c1-c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C15H12Cl2O4/c1-20-12-6-9(15(18)19)7-13(21-2)14(12)8-3-4-10(16)11(17)5-8/h3-7H,1-2H3,(H,18,19)
InChIKeyHFJLWZOWQVFVTO-UHFFFAOYSA-N
XLogP4.38
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.16
LogP ≤ 54.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid?
The IUPAC name of 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid (CID 16768707) is 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid.
What is the SMILES notation for 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid?
The canonical SMILES for 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid is COc1cc(C(=O)O)cc(OC)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid?
The InChIKey is HFJLWZOWQVFVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2O4/c1-20-12-6-9(15(18)19)7-13(21-2)14(12)8-3-4-10(16)11(17)5-8/h3-7H,1-2H3,(H,18,19).
What are the key properties of 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid?
4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid has a molecular weight of 327.16 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)-3,5-dimethoxybenzoic acid is sourced from PubChem (CID 16768707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).